C19H15BrN4O3 — CID 126294402
2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 126294402) has the molecular formula C19H15BrN4O3 and a molecular weight of 427.26 g/mol. Its IUPAC name is 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 126294402 |
| Molecular Formula | C19H15BrN4O3 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1cccc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c1OCC#N |
| InChI | InChI=1S/C19H15BrN4O3/c1-12-23-16-7-6-14(20)10-15(16)19(25)24(12)22-11-13-4-3-5-17(26-2)18(13)27-9-8-21/h3-7,10-11H,9H2,1-2H3 |
| InChIKey | FFSXXGUCUOCXAJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|