C24H19BrClN3O3 — CID 126307638
6-bromo-3-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126307638) has the molecular formula C24H19BrClN3O3 and a molecular weight of 512.79 g/mol. Its IUPAC name is 6-bromo-3-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126307638 |
| Molecular Formula | C24H19BrClN3O3 |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 6-bromo-3-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | COc1cccc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19BrClN3O3/c1-15-28-21-11-8-18(25)12-20(21)24(30)29(15)27-13-17-4-3-5-22(31-2)23(17)32-14-16-6-9-19(26)10-7-16/h3-13H,14H2,1-2H3 |
| InChIKey | CMTMVPPPAXOMIY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|