C19H16BrN3O4 — CID 126299728
[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate (PubChem CID 126299728) has the molecular formula C19H16BrN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is [2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate.
| Compound Name | [2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 126299728 |
| Molecular Formula | C19H16BrN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | [2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cccc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c1OC(C)=O |
| InChI | InChI=1S/C19H16BrN3O4/c1-11-22-16-8-7-14(20)9-15(16)19(25)23(11)21-10-13-5-4-6-17(26-3)18(13)27-12(2)24/h4-10H,1-3H3 |
| InChIKey | YYBFVVIOJFMPGD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|