C19H15BrN4O2 — CID 126297062
2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile (PubChem CID 126297062) has the molecular formula C19H15BrN4O2 and a molecular weight of 411.26 g/mol. Its IUPAC name is 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126297062 |
| Molecular Formula | C19H15BrN4O2 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccccc1OCC#N |
| InChI | InChI=1S/C19H15BrN4O2/c1-2-18-23-16-8-7-14(20)11-15(16)19(25)24(18)22-12-13-5-3-4-6-17(13)26-10-9-21/h3-8,11-12H,2,10H2,1H3 |
| InChIKey | NWKKSFJDXMEMHA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|