C23H21BrN4O3 — CID 126310277
2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetonitrile (PubChem CID 126310277) has the molecular formula C23H21BrN4O3 and a molecular weight of 481.35 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetonitrile.
| Compound Name | 2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetonitrile |
|---|---|
| PubChem CID | 126310277 |
| Molecular Formula | C23H21BrN4O3 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetonitrile |
| SMILES | C=CCc1cc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)cc(OC)c1OCC#N |
| InChI | InChI=1S/C23H21BrN4O3/c1-4-6-16-11-15(12-20(30-3)22(16)31-10-9-25)14-26-28-21(5-2)27-19-8-7-17(24)13-18(19)23(28)29/h4,7-8,11-14H,1,5-6,10H2,2-3H3 |
| InChIKey | KGERROHQJBWTCO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|