C23H18BrN3OS — CID 126294577
6-bromo-2-ethyl-3-[(2-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126294577) has the molecular formula C23H18BrN3OS and a molecular weight of 464.39 g/mol. Its IUPAC name is 6-bromo-2-ethyl-3-[(2-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-ethyl-3-[(2-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294577 |
| Molecular Formula | C23H18BrN3OS |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 6-bromo-2-ethyl-3-[(2-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C23H18BrN3OS/c1-2-22-26-20-13-12-17(24)14-19(20)23(28)27(22)25-15-16-8-6-7-11-21(16)29-18-9-4-3-5-10-18/h3-15H,2H2,1H3 |
| InChIKey | HFPFIGOBHYWKSU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|