C24H20BrN3OS — CID 126308570
6-bromo-3-[(4-phenylsulfanylphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 126308570) has the molecular formula C24H20BrN3OS and a molecular weight of 478.42 g/mol. Its IUPAC name is 6-bromo-3-[(4-phenylsulfanylphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(4-phenylsulfanylphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126308570 |
| Molecular Formula | C24H20BrN3OS |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 6-bromo-3-[(4-phenylsulfanylphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20BrN3OS/c1-16(2)23-27-22-13-10-18(25)14-21(22)24(29)28(23)26-15-17-8-11-20(12-9-17)30-19-6-4-3-5-7-19/h3-16H,1-2H3 |
| InChIKey | DVPVZSOIUDAYOA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|