C20H20Br2N4O — CID 126284645
6-bromo-3-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 126284645) has the molecular formula C20H20Br2N4O and a molecular weight of 492.22 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126284645 |
| Molecular Formula | C20H20Br2N4O |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 6-bromo-3-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(N(C)C)c(Br)c1 |
| InChI | InChI=1S/C20H20Br2N4O/c1-12(2)19-24-17-7-6-14(21)10-15(17)20(27)26(19)23-11-13-5-8-18(25(3)4)16(22)9-13/h5-12H,1-4H3 |
| InChIKey | DHXMEOAZIRHYOD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|