C26H32BrN3O2 — CID 137125819
6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 137125819) has the molecular formula C26H32BrN3O2 and a molecular weight of 498.47 g/mol. Its IUPAC name is 6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 137125819 |
| Molecular Formula | C26H32BrN3O2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H32BrN3O2/c1-15(2)23-29-21-10-9-17(27)13-18(21)24(32)30(23)28-14-16-11-19(25(3,4)5)22(31)20(12-16)26(6,7)8/h9-15,31H,1-8H3 |
| InChIKey | PUFIRCSYUARLRT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|