C18H14BrClN4O4 — CID 137125732
6-bromo-3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 137125732) has the molecular formula C18H14BrClN4O4 and a molecular weight of 465.69 g/mol. Its IUPAC name is 6-bromo-3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 137125732 |
| Molecular Formula | C18H14BrClN4O4 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | 6-bromo-3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14BrClN4O4/c1-9(2)17-22-14-4-3-11(19)7-12(14)18(26)23(17)21-8-10-5-13(20)16(25)15(6-10)24(27)28/h3-9,25H,1-2H3 |
| InChIKey | IFDGRBYWGFJWJO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|