C20H19BrN4O5 — CID 137068267
6-bromo-2-[(2R)-butan-2-yl]-3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 137068267) has the molecular formula C20H19BrN4O5 and a molecular weight of 475.30 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 137068267 |
| Molecular Formula | C20H19BrN4O5 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19BrN4O5/c1-4-11(2)19-23-15-6-5-13(21)9-14(15)20(27)24(19)22-10-12-7-16(25(28)29)18(26)17(8-12)30-3/h5-11,26H,4H2,1-3H3/t11-/m1/s1 |
| InChIKey | LTJUXOUXZYUBSY-LLVKDONJSA-N |
| XLogP | 4.18 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|