C22H21BrN4O6 — CID 126337578
[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenyl] acetate (PubChem CID 126337578) has the molecular formula C22H21BrN4O6 and a molecular weight of 517.34 g/mol. Its IUPAC name is [4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenyl] acetate.
| Compound Name | [4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenyl] acetate |
|---|---|
| PubChem CID | 126337578 |
| Molecular Formula | C22H21BrN4O6 |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | [4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenyl] acetate |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(OC(C)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H21BrN4O6/c1-5-12(2)21-25-17-7-6-15(23)10-16(17)22(29)26(21)24-11-14-8-18(27(30)31)20(33-13(3)28)19(9-14)32-4/h6-12H,5H2,1-4H3/t12-/m0/s1 |
| InChIKey | DERGSNCLGBSOEF-LBPRGKRZSA-N |
| XLogP | 4.40 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|