C19H16BrClN4O4 — CID 126288415
6-bromo-3-[(5-chloro-2-methoxy-3-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 126288415) has the molecular formula C19H16BrClN4O4 and a molecular weight of 479.72 g/mol. Its IUPAC name is 6-bromo-3-[(5-chloro-2-methoxy-3-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(5-chloro-2-methoxy-3-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126288415 |
| Molecular Formula | C19H16BrClN4O4 |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 6-bromo-3-[(5-chloro-2-methoxy-3-nitrophenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | COc1c(C=Nn2c(C(C)C)nc3ccc(Br)cc3c2=O)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16BrClN4O4/c1-10(2)18-23-15-5-4-12(20)7-14(15)19(26)24(18)22-9-11-6-13(21)8-16(25(27)28)17(11)29-3/h4-10H,1-3H3 |
| InChIKey | PEYWQMZVGYCRFK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|