C26H21BrClN5O5 — CID 126290466
2-[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]-N-phenylacetamide (PubChem CID 126290466) has the molecular formula C26H21BrClN5O5 and a molecular weight of 598.84 g/mol. Its IUPAC name is 2-[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126290466 |
| Molecular Formula | C26H21BrClN5O5 |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 597.04 |
| IUPAC Name | 2-[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]-N-phenylacetamide |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc([N+](=O)[O-])c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H21BrClN5O5/c1-15(2)25-31-21-9-8-17(27)11-20(21)26(35)32(25)29-13-16-10-18(28)12-22(33(36)37)24(16)38-14-23(34)30-19-6-4-3-5-7-19/h3-13,15H,14H2,1-2H3,(H,30,34) |
| InChIKey | QWXYXLQECLOMFB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|