C27H24BrN3OS — CID 126323393
6-bromo-2-cyclohexyl-3-[(4-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126323393) has the molecular formula C27H24BrN3OS and a molecular weight of 518.48 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[(4-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[(4-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323393 |
| Molecular Formula | C27H24BrN3OS |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[(4-phenylsulfanylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C27H24BrN3OS/c28-21-13-16-25-24(17-21)27(32)31(26(30-25)20-7-3-1-4-8-20)29-18-19-11-14-23(15-12-19)33-22-9-5-2-6-10-22/h2,5-6,9-18,20H,1,3-4,7-8H2 |
| InChIKey | SXWPQKMEVWLSEF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|