C25H22Br2N4O — CID 126323913
6-bromo-3-[[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126323913) has the molecular formula C25H22Br2N4O and a molecular weight of 554.29 g/mol. Its IUPAC name is 6-bromo-3-[[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126323913 |
| Molecular Formula | C25H22Br2N4O |
| Molecular Weight | 554.29 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | 6-bromo-3-[[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1cccn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C25H22Br2N4O/c26-18-8-4-9-20(14-18)30-13-5-10-21(30)16-28-31-24(17-6-2-1-3-7-17)29-23-12-11-19(27)15-22(23)25(31)32/h4-5,8-17H,1-3,6-7H2 |
| InChIKey | SEXINKLHKLVEKU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.29 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|