C25H21BrClN3O2S — CID 126329216
6-bromo-3-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126329216) has the molecular formula C25H21BrClN3O2S and a molecular weight of 542.89 g/mol. Its IUPAC name is 6-bromo-3-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126329216 |
| Molecular Formula | C25H21BrClN3O2S |
| Molecular Weight | 542.89 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 6-bromo-3-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C25H21BrClN3O2S/c26-17-6-12-22-21(14-17)25(31)30(24(29-22)16-4-2-1-3-5-16)28-15-19-9-13-23(32-19)33-20-10-7-18(27)8-11-20/h6-16H,1-5H2 |
| InChIKey | MWHASRWRXRWUFH-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.89 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|