C25H20Br2ClN3O2S — CID 126325376
6-bromo-3-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126325376) has the molecular formula C25H20Br2ClN3O2S and a molecular weight of 621.78 g/mol. Its IUPAC name is 6-bromo-3-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126325376 |
| Molecular Formula | C25H20Br2ClN3O2S |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 618.93 |
| IUPAC Name | 6-bromo-3-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1cc(Br)c(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C25H20Br2ClN3O2S/c26-16-6-11-22-20(12-16)24(32)31(23(30-22)15-4-2-1-3-5-15)29-14-18-13-21(27)25(33-18)34-19-9-7-17(28)8-10-19/h6-15H,1-5H2 |
| InChIKey | CHXBHVITPDXNAK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|