C28H24Br2ClN3O2 — CID 126321142
6-bromo-3-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126321142) has the molecular formula C28H24Br2ClN3O2 and a molecular weight of 629.78 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126321142 |
| Molecular Formula | C28H24Br2ClN3O2 |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 626.99 |
| IUPAC Name | 6-bromo-3-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(C2CCCCC2)n1N=Cc1ccc(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C28H24Br2ClN3O2/c29-21-9-12-25-23(15-21)28(35)34(27(33-25)20-4-2-1-3-5-20)32-16-19-8-13-26(24(30)14-19)36-17-18-6-10-22(31)11-7-18/h6-16,20H,1-5,17H2 |
| InChIKey | UMQSHVVTPUMFPP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|