C21H17Br2ClN4O3 — CID 126289039
2-[3-bromo-4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile (PubChem CID 126289039) has the molecular formula C21H17Br2ClN4O3 and a molecular weight of 568.65 g/mol. Its IUPAC name is 2-[3-bromo-4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile.
| Compound Name | 2-[3-bromo-4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 126289039 |
| Molecular Formula | C21H17Br2ClN4O3 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | 2-[3-bromo-4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile |
| SMILES | CCOc1cc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)c(Br)c(Cl)c1OCC#N |
| InChI | InChI=1S/C21H17Br2ClN4O3/c1-3-17-27-15-6-5-13(22)10-14(15)21(29)28(17)26-11-12-9-16(30-4-2)20(31-8-7-25)19(24)18(12)23/h5-6,9-11H,3-4,8H2,1-2H3 |
| InChIKey | PJTNYHCNAUFWQT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|