C22H20BrClN4O3 — CID 126323545
2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile (PubChem CID 126323545) has the molecular formula C22H20BrClN4O3 and a molecular weight of 503.78 g/mol. Its IUPAC name is 2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 126323545 |
| Molecular Formula | C22H20BrClN4O3 |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]acetonitrile |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(OCC#N)c(OCC)c1 |
| InChI | InChI=1S/C22H20BrClN4O3/c1-3-5-20-27-18-7-6-15(23)12-16(18)22(29)28(20)26-13-14-10-17(24)21(31-9-8-25)19(11-14)30-4-2/h6-7,10-13H,3-5,9H2,1-2H3 |
| InChIKey | QGKWOEPKPBLXIO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|