C26H21Br3ClN3O3 — CID 126284917
6-bromo-3-[[2,3-dibromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126284917) has the molecular formula C26H21Br3ClN3O3 and a molecular weight of 698.64 g/mol. Its IUPAC name is 6-bromo-3-[[2,3-dibromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2,3-dibromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126284917 |
| Molecular Formula | C26H21Br3ClN3O3 |
| Molecular Weight | 698.64 g/mol |
| Exact Mass | 694.88 |
| IUPAC Name | 6-bromo-3-[[2,3-dibromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)c(Br)c(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21Br3ClN3O3/c1-3-22-32-20-10-7-17(27)12-19(20)26(34)33(22)31-13-16-11-21(35-4-2)25(24(29)23(16)28)36-14-15-5-8-18(30)9-6-15/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | FVHOIFVFXMYLCJ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|