C25H20N4O8 — CID 126366237
3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126366237) has the molecular formula C25H20N4O8 and a molecular weight of 504.46 g/mol. Its IUPAC name is 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126366237 |
| Molecular Formula | C25H20N4O8 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H20N4O8/c1-2-36-21-12-16(13-26-28-23(30)18-8-3-4-9-19(18)27-25(28)33)11-20(29(34)35)22(21)37-14-15-6-5-7-17(10-15)24(31)32/h3-13H,2,14H2,1H3,(H,27,33)(H,31,32) |
| InChIKey | RDJWKKNWPQHSLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 166.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|