C33H24N4O8 — CID 126291046
3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126291046) has the molecular formula C33H24N4O8 and a molecular weight of 604.58 g/mol. Its IUPAC name is 3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126291046 |
| Molecular Formula | C33H24N4O8 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C33H24N4O8/c1-2-43-28-16-21(15-26(37(41)42)30(28)44-19-20-8-7-10-23(14-20)33(39)40)18-34-36-31(29-17-22-9-3-6-13-27(22)45-29)35-25-12-5-4-11-24(25)32(36)38/h3-18H,2,19H2,1H3,(H,39,40) |
| InChIKey | URVOCZWALQRAEY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 159.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|