C18H17N5O2 — CID 126014186
N-(4-methylphenyl)-2-[4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetamide (PubChem CID 126014186) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126014186 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=N/n3cnnc3)cc2)cc1 |
| InChI | InChI=1S/C18H17N5O2/c1-14-2-6-16(7-3-14)22-18(24)11-25-17-8-4-15(5-9-17)10-21-23-12-19-20-13-23/h2-10,12-13H,11H2,1H3,(H,22,24)/b21-10+ |
| InChIKey | PNXYBXIZYBPIAU-UFFVCSGVSA-N |
| XLogP | 2.49 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|