C26H23ClN4O5 — CID 126371064
2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126371064) has the molecular formula C26H23ClN4O5 and a molecular weight of 506.95 g/mol. Its IUPAC name is 2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126371064 |
| Molecular Formula | C26H23ClN4O5 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H23ClN4O5/c1-3-35-22-13-17(14-28-31-25(33)19-6-4-5-7-21(19)30-26(31)34)12-20(27)24(22)36-15-23(32)29-18-10-8-16(2)9-11-18/h4-14H,3,15H2,1-2H3,(H,29,32)(H,30,34) |
| InChIKey | QWGIBVVWZHZRIA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|