C27H19ClN4O7 — CID 126309674
methyl (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]propanoate (PubChem CID 126309674) has the molecular formula C27H19ClN4O7 and a molecular weight of 546.92 g/mol. Its IUPAC name is methyl (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126309674 |
| Molecular Formula | C27H19ClN4O7 |
| Molecular Weight | 546.92 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | methyl (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(Cl)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H19ClN4O7/c1-15(27(34)37-2)38-24-19(28)11-16(12-21(24)32(35)36)14-29-31-25(23-13-17-7-3-6-10-22(17)39-23)30-20-9-5-4-8-18(20)26(31)33/h3-15H,1-2H3/t15-/m1/s1 |
| InChIKey | HFQYLFSVEMDUHF-OAHLLOKOSA-N |
| XLogP | 5.19 |
| TPSA | 139.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|