C28H21BrN4O7 — CID 126280293
ethyl (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-nitrophenoxy]propanoate (PubChem CID 126280293) has the molecular formula C28H21BrN4O7 and a molecular weight of 605.40 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-nitrophenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126280293 |
| Molecular Formula | C28H21BrN4O7 |
| Molecular Weight | 605.40 g/mol |
| Exact Mass | 604.06 |
| IUPAC Name | ethyl (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(Br)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H21BrN4O7/c1-3-38-28(35)16(2)39-25-20(29)12-17(13-22(25)33(36)37)15-30-32-26(24-14-18-8-4-7-11-23(18)40-24)31-21-10-6-5-9-19(21)27(32)34/h4-16H,3H2,1-2H3/t16-/m0/s1 |
| InChIKey | BPSWSXCBEAXNNO-INIZCTEOSA-N |
| XLogP | 5.69 |
| TPSA | 139.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|