C16H11N3O3S — CID 9031519
4-[(Z)-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)iminomethyl]benzoic acid (PubChem CID 9031519) has the molecular formula C16H11N3O3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-[(Z)-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)iminomethyl]benzoic acid.
| Compound Name | 4-[(Z)-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 9031519 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 4-[(Z)-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N\n2c(=S)[nH]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C16H11N3O3S/c20-14-12-3-1-2-4-13(12)18-16(23)19(14)17-9-10-5-7-11(8-6-10)15(21)22/h1-9H,(H,18,23)(H,21,22)/b17-9- |
| InChIKey | GBILRSCFGGSRDM-MFOYZWKCSA-N |
| XLogP | 2.64 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|