C13H9N3OS2 — CID 9031584
2-sulfanylidene-3-[(Z)-thiophen-3-ylmethylideneamino]-1H-quinazolin-4-one (PubChem CID 9031584) has the molecular formula C13H9N3OS2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-sulfanylidene-3-[(Z)-thiophen-3-ylmethylideneamino]-1H-quinazolin-4-one.
| Compound Name | 2-sulfanylidene-3-[(Z)-thiophen-3-ylmethylideneamino]-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 9031584 |
| Molecular Formula | C13H9N3OS2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-sulfanylidene-3-[(Z)-thiophen-3-ylmethylideneamino]-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1/N=C\c1ccsc1 |
| InChI | InChI=1S/C13H9N3OS2/c17-12-10-3-1-2-4-11(10)15-13(18)16(12)14-7-9-5-6-19-8-9/h1-8H,(H,15,18)/b14-7- |
| InChIKey | WYPRSLZYJKBKFV-AUWJEWJLSA-N |
| XLogP | 3.00 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|