About 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one
3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 9031952) has the molecular formula C16H10ClN3O3S
and a molecular weight of 359.79 g/mol. Its IUPAC name is 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
| PubChem CID | 9031952 |
| Molecular Formula | C16H10ClN3O3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1/N=C\c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C16H10ClN3O3S/c17-11-5-9(6-13-14(11)23-8-22-13)7-18-20-15(21)10-3-1-2-4-12(10)19-16(20)24/h1-7H,8H2,(H,19,24)/b18-7- |
| InChIKey | RAEGJTDCAFVPDS-WSVATBPTSA-N |
| XLogP | 3.32 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one?
The IUPAC name of 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one (CID 9031952) is 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one.
What is the SMILES notation for 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one?
The canonical SMILES for 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one is O=c1c2ccccc2[nH]c(=S)n1/N=C\c1cc(Cl)c2c(c1)OCO2.
What is the InChIKey of 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one?
The InChIKey is RAEGJTDCAFVPDS-WSVATBPTSA-N. The full InChI is InChI=1S/C16H10ClN3O3S/c17-11-5-9(6-13-14(11)23-8-22-13)7-18-20-15(21)10-3-1-2-4-12(10)19-16(20)24/h1-7H,8H2,(H,19,24)/b18-7-.
What are the key properties of 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one?
3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one has a molecular weight of 359.79 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one is sourced from PubChem (CID 9031952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).