C17H15N3OS — CID 9031592
3-[(Z)-3-phenylpropylideneamino]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 9031592) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[(Z)-3-phenylpropylideneamino]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(Z)-3-phenylpropylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 9031592 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-[(Z)-3-phenylpropylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C17H15N3OS/c21-16-14-10-4-5-11-15(14)19-17(22)20(16)18-12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-12H,6,9H2,(H,19,22)/b18-12- |
| InChIKey | AIWGIUNILVEUAF-PDGQHHTCSA-N |
| XLogP | 3.53 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|