C20H15N3O2S — CID 23376507
3-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 23376507) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 3-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 23376507 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1ccc2ccccc2c1C=Nn1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H15N3O2S/c1-25-18-11-10-13-6-2-3-7-14(13)16(18)12-21-23-19(24)15-8-4-5-9-17(15)22-20(23)26/h2-12H,1H3,(H,22,26) |
| InChIKey | FSWBJAOJBKFOQU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|