C16H12F2N4O2S — CID 9359203
4-[(Z)-[2-(difluoromethoxy)naphthalen-1-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 9359203) has the molecular formula C16H12F2N4O2S and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-[(Z)-[2-(difluoromethoxy)naphthalen-1-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-[2-(difluoromethoxy)naphthalen-1-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 9359203 |
| Molecular Formula | C16H12F2N4O2S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 4-[(Z)-[2-(difluoromethoxy)naphthalen-1-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Cc1n[nH]c(=S)n(/N=C\c2c(OC(F)F)ccc3ccccc23)c1=O |
| InChI | InChI=1S/C16H12F2N4O2S/c1-9-14(23)22(16(25)21-20-9)19-8-12-11-5-3-2-4-10(11)6-7-13(12)24-15(17)18/h2-8,15H,1H3,(H,21,25)/b19-8- |
| InChIKey | QQPRRQXIBONWDX-UWVJOHFNSA-N |
| XLogP | 3.25 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|