C11H8ClFN4OS — CID 6862594
4-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 6862594) has the molecular formula C11H8ClFN4OS and a molecular weight of 298.73 g/mol. Its IUPAC name is 4-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 6862594 |
| Molecular Formula | C11H8ClFN4OS |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Cc1n[nH]c(=S)n(/N=C/c2c(F)cccc2Cl)c1=O |
| InChI | InChI=1S/C11H8ClFN4OS/c1-6-10(18)17(11(19)16-15-6)14-5-7-8(12)3-2-4-9(7)13/h2-5H,1H3,(H,16,19)/b14-5+ |
| InChIKey | NRWXFRXHJBXMFU-LHHJGKSTSA-N |
| XLogP | 2.28 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|