C14H13Cl3N4OS — CID 110507663
6-tert-butyl-3-sulfanylidene-4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-2H-1,2,4-triazin-5-one (PubChem CID 110507663) has the molecular formula C14H13Cl3N4OS and a molecular weight of 391.71 g/mol. Its IUPAC name is 6-tert-butyl-3-sulfanylidene-4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-2H-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-3-sulfanylidene-4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 110507663 |
| Molecular Formula | C14H13Cl3N4OS |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 6-tert-butyl-3-sulfanylidene-4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-2H-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1n[nH]c(=S)n(/N=C\c2c(Cl)ccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C14H13Cl3N4OS/c1-14(2,3)11-12(22)21(13(23)20-19-11)18-6-7-8(15)4-5-9(16)10(7)17/h4-6H,1-3H3,(H,20,23)/b18-6- |
| InChIKey | OFOWSXIXYDZSQG-FXBPXSCXSA-N |
| XLogP | 4.44 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|