C10H4Cl3F3N4S — CID 110521463
4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 110521463) has the molecular formula C10H4Cl3F3N4S and a molecular weight of 375.59 g/mol. Its IUPAC name is 4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110521463 |
| Molecular Formula | C10H4Cl3F3N4S |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 4-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)(F)c1n[nH]c(=S)n1N=Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H4Cl3F3N4S/c11-5-1-2-6(12)7(13)4(5)3-17-20-8(10(14,15)16)18-19-9(20)21/h1-3H,(H,19,21) |
| InChIKey | OSTCZIPSMZYWSG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|