C14H15N5O3S — CID 6880483
6-tert-butyl-4-[(E)-(2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 6880483) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 6-tert-butyl-4-[(E)-(2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-4-[(E)-(2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 6880483 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 6-tert-butyl-4-[(E)-(2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1n[nH]c(=S)n(/N=C/c2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C14H15N5O3S/c1-14(2,3)11-12(20)18(13(23)17-16-11)15-8-9-6-4-5-7-10(9)19(21)22/h4-8H,1-3H3,(H,17,23)/b15-8+ |
| InChIKey | VVMXPHXXBAMAKA-OVCLIPMQSA-N |
| XLogP | 2.39 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|