C10H8N4O2S2 — CID 9295141
4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]benzoic acid (PubChem CID 9295141) has the molecular formula C10H8N4O2S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]benzoic acid.
| Compound Name | 4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 9295141 |
| Molecular Formula | C10H8N4O2S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N\n2c(=S)[nH][nH]c2=S)cc1 |
| InChI | InChI=1S/C10H8N4O2S2/c15-8(16)7-3-1-6(2-4-7)5-11-14-9(17)12-13-10(14)18/h1-5H,(H,12,17)(H,13,18)(H,15,16)/b11-5- |
| InChIKey | WFORVZRASABXEJ-WZUFQYTHSA-N |
| XLogP | 2.18 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|