C11H7N4O3S- — CID 6259063
4-[(Z)-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]benzoate (PubChem CID 6259063) has the molecular formula C11H7N4O3S- and a molecular weight of 275.27 g/mol. Its IUPAC name is 4-[(Z)-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]benzoate.
| Compound Name | 4-[(Z)-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 6259063 |
| Molecular Formula | C11H7N4O3S- |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 4-[(Z)-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]benzoate |
| SMILES | O=C([O-])c1ccc(/C=N\n2c(=O)cn[nH]c2=S)cc1 |
| InChI | InChI=1S/C11H8N4O3S/c16-9-6-12-14-11(19)15(9)13-5-7-1-3-8(4-2-7)10(17)18/h1-6H,(H,14,19)(H,17,18)/p-1/b13-5- |
| InChIKey | AZJGOPWPAQMFRK-ACAGNQJTSA-M |
| XLogP | -0.45 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|