C10H7FN4OS — CID 112537901
4-[(Z)-(3-fluorophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 112537901) has the molecular formula C10H7FN4OS and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-[(Z)-(3-fluorophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-(3-fluorophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 112537901 |
| Molecular Formula | C10H7FN4OS |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 4-[(Z)-(3-fluorophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | O=c1cn[nH]c(=S)n1/N=C\c1cccc(F)c1 |
| InChI | InChI=1S/C10H7FN4OS/c11-8-3-1-2-7(4-8)5-13-15-9(16)6-12-14-10(15)17/h1-6H,(H,14,17)/b13-5- |
| InChIKey | WEPUVNFAXXEMMH-ACAGNQJTSA-N |
| XLogP | 1.32 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|