C17H12Cl2N4O2S — CID 1178708
4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 1178708) has the molecular formula C17H12Cl2N4O2S and a molecular weight of 407.28 g/mol. Its IUPAC name is 4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 1178708 |
| Molecular Formula | C17H12Cl2N4O2S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | O=c1cn[nH]c(=S)n1N=Cc1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N4O2S/c18-13-5-4-12(15(19)7-13)10-25-14-3-1-2-11(6-14)8-21-23-16(24)9-20-22-17(23)26/h1-9H,10H2,(H,22,26) |
| InChIKey | QGDMTMRGHNYFGQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|