C16H13ClN4OS — CID 110340578
4-[(E)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 110340578) has the molecular formula C16H13ClN4OS and a molecular weight of 344.83 g/mol. Its IUPAC name is 4-[(E)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110340578 |
| Molecular Formula | C16H13ClN4OS |
| Molecular Weight | 344.83 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-[(E)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1/N=C/c1cccc(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H13ClN4OS/c17-14-6-4-12(5-7-14)10-22-15-3-1-2-13(8-15)9-19-21-11-18-20-16(21)23/h1-9,11H,10H2,(H,20,23)/b19-9+ |
| InChIKey | YYUZZBYZPUYDLC-DJKKODMXSA-N |
| XLogP | 4.06 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|