C16H10Cl4N4OS — CID 11762107
4-[(E)-(3-chlorophenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 11762107) has the molecular formula C16H10Cl4N4OS and a molecular weight of 448.16 g/mol. Its IUPAC name is 4-[(E)-(3-chlorophenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(3-chlorophenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11762107 |
| Molecular Formula | C16H10Cl4N4OS |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 4-[(E)-(3-chlorophenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(COc2c(Cl)cc(Cl)cc2Cl)n1/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H10Cl4N4OS/c17-10-3-1-2-9(4-10)7-21-24-14(22-23-16(24)26)8-25-15-12(19)5-11(18)6-13(15)20/h1-7H,8H2,(H,23,26)/b21-7+ |
| InChIKey | UUBUPDHOWUKHFN-QPSGOUHRSA-N |
| XLogP | 6.02 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|