C17H13Cl3N4O2S — CID 10906359
4-[(E)-(4-methoxyphenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 10906359) has the molecular formula C17H13Cl3N4O2S and a molecular weight of 443.74 g/mol. Its IUPAC name is 4-[(E)-(4-methoxyphenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(4-methoxyphenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10906359 |
| Molecular Formula | C17H13Cl3N4O2S |
| Molecular Weight | 443.74 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 4-[(E)-(4-methoxyphenyl)methylideneamino]-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(/C=N/n2c(COc3c(Cl)cc(Cl)cc3Cl)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H13Cl3N4O2S/c1-25-12-4-2-10(3-5-12)8-21-24-15(22-23-17(24)27)9-26-16-13(19)6-11(18)7-14(16)20/h2-8H,9H2,1H3,(H,23,27)/b21-8+ |
| InChIKey | ONJICFYHTZCOBS-ODCIPOBUSA-N |
| XLogP | 5.37 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.74 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|