C18H16Cl2N4OS — CID 110520010
4-[(Z)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 110520010) has the molecular formula C18H16Cl2N4OS and a molecular weight of 407.33 g/mol. Its IUPAC name is 4-[(Z)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520010 |
| Molecular Formula | C18H16Cl2N4OS |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 4-[(Z)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1c(Cl)cc(/C=N\n2c(CCc3ccccc3)n[nH]c2=S)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N4OS/c1-25-17-14(19)9-13(10-15(17)20)11-21-24-16(22-23-18(24)26)8-7-12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3,(H,23,26)/b21-11- |
| InChIKey | CZNNMKGLXROGRT-NHDPSOOVSA-N |
| XLogP | 4.92 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|