C14H18N4OS2 — CID 9295347
4-[(Z)-(4-pentoxyphenyl)methylideneamino]-1,2,4-triazolidine-3,5-dithione (PubChem CID 9295347) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 4-[(Z)-(4-pentoxyphenyl)methylideneamino]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[(Z)-(4-pentoxyphenyl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 9295347 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[(Z)-(4-pentoxyphenyl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
| SMILES | CCCCCOc1ccc(/C=N\n2c(=S)[nH][nH]c2=S)cc1 |
| InChI | InChI=1S/C14H18N4OS2/c1-2-3-4-9-19-12-7-5-11(6-8-12)10-15-18-13(20)16-17-14(18)21/h5-8,10H,2-4,9H2,1H3,(H,16,20)(H,17,21)/b15-10- |
| InChIKey | WKBCCAQXBIAAEO-GDNBJRDFSA-N |
| XLogP | 4.05 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|