C19H25N3O2 — CID 9024322
6-amino-1-[(Z)-(4-hexoxyphenyl)methylideneamino]-4-methylpyridin-2-one (PubChem CID 9024322) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 6-amino-1-[(Z)-(4-hexoxyphenyl)methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(Z)-(4-hexoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 9024322 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 6-amino-1-[(Z)-(4-hexoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
| SMILES | CCCCCCOc1ccc(/C=N\n2c(N)cc(C)cc2=O)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-3-4-5-6-11-24-17-9-7-16(8-10-17)14-21-22-18(20)12-15(2)13-19(22)23/h7-10,12-14H,3-6,11,20H2,1-2H3/b21-14- |
| InChIKey | QBRJQOBRCBYDGQ-STZFKDTASA-N |
| XLogP | 3.58 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|