C15H15N3O3 — CID 9024468
methyl 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]benzoate (PubChem CID 9024468) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]benzoate.
| Compound Name | methyl 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 9024468 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\n2c(N)cc(C)cc2=O)cc1 |
| InChI | InChI=1S/C15H15N3O3/c1-10-7-13(16)18(14(19)8-10)17-9-11-3-5-12(6-4-11)15(20)21-2/h3-9H,16H2,1-2H3/b17-9- |
| InChIKey | XMYRZZZFWLBNNW-MFOYZWKCSA-N |
| XLogP | 1.41 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|