C26H21N5O4S — CID 6890407
methyl 4-[(E)-[2-amino-3-(3-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate (PubChem CID 6890407) has the molecular formula C26H21N5O4S and a molecular weight of 499.55 g/mol. Its IUPAC name is methyl 4-[(E)-[2-amino-3-(3-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-[2-amino-3-(3-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 6890407 |
| Molecular Formula | C26H21N5O4S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | methyl 4-[(E)-[2-amino-3-(3-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/n2c(N)c(S(=O)(=O)c3cccc(C)c3)c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C26H21N5O4S/c1-16-6-5-7-19(14-16)36(33,34)23-22-25(30-21-9-4-3-8-20(21)29-22)31(24(23)27)28-15-17-10-12-18(13-11-17)26(32)35-2/h3-15H,27H2,1-2H3/b28-15+ |
| InChIKey | CCCSLPAGNOPGAM-RWPZCVJISA-N |
| XLogP | 3.98 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|